C20H30Cl2N2O — CID 119769962
N-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119769962) has the molecular formula C20H30Cl2N2O and a molecular weight of 385.38 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119769962 |
| Molecular Formula | C20H30Cl2N2O |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[[1-(4-chlorophenyl)cyclobutyl]methyl]-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCC1(c2ccc(Cl)cc2)CCC1)C1CCNCC1.Cl |
| InChI | InChI=1S/C20H29ClN2O.ClH/c1-15(16-7-11-22-12-8-16)13-19(24)23-14-20(9-2-10-20)17-3-5-18(21)6-4-17;/h3-6,15-16,22H,2,7-14H2,1H3,(H,23,24);1H |
| InChIKey | QWYLZANREDVKMT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |