C14H19N3O4S2 — CID 55658583
N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-5-nitrothiophene-2-carboxamide (PubChem CID 55658583) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55658583 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-5-nitrothiophene-2-carboxamide |
| SMILES | O=C(NCC1(N2CCOCC2)CCSC1)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H19N3O4S2/c18-13(11-1-2-12(23-11)17(19)20)15-9-14(3-8-22-10-14)16-4-6-21-7-5-16/h1-2H,3-10H2,(H,15,18) |
| InChIKey | DBIBFODVKJMFFK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|