C18H26N4O4S — CID 36532677
2-(dimethylamino)-N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-5-nitrobenzamide (PubChem CID 36532677) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-5-nitrobenzamide.
| Compound Name | 2-(dimethylamino)-N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 36532677 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2-(dimethylamino)-N-[[(3R)-3-morpholin-4-ylthiolan-3-yl]methyl]-5-nitrobenzamide |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1C(=O)NC[C@]1(N2CCOCC2)CCSC1 |
| InChI | InChI=1S/C18H26N4O4S/c1-20(2)16-4-3-14(22(24)25)11-15(16)17(23)19-12-18(5-10-27-13-18)21-6-8-26-9-7-21/h3-4,11H,5-10,12-13H2,1-2H3,(H,19,23)/t18-/m1/s1 |
| InChIKey | XTZHZCQWXLNPFR-GOSISDBHSA-N |
| XLogP | 1.60 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|