C18H24ClFN2O2 — CID 18150722
5-chloro-2-fluoro-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide (PubChem CID 18150722) has the molecular formula C18H24ClFN2O2 and a molecular weight of 354.85 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide.
| Compound Name | 5-chloro-2-fluoro-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 18150722 |
| Molecular Formula | C18H24ClFN2O2 |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 5-chloro-2-fluoro-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide |
| SMILES | O=C(NCC1(N2CCOCC2)CCCCC1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C18H24ClFN2O2/c19-14-4-5-16(20)15(12-14)17(23)21-13-18(6-2-1-3-7-18)22-8-10-24-11-9-22/h4-5,12H,1-3,6-11,13H2,(H,21,23) |
| InChIKey | ZZPTVFBZGBRIPF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |