C20H27ClN2O5 — CID 55536838
[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 4-chloro-2-hydroxybenzoate (PubChem CID 55536838) has the molecular formula C20H27ClN2O5 and a molecular weight of 410.90 g/mol. Its IUPAC name is [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 4-chloro-2-hydroxybenzoate.
| Compound Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 55536838 |
| Molecular Formula | C20H27ClN2O5 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 4-chloro-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)cc1O)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C20H27ClN2O5/c21-15-4-5-16(17(24)12-15)19(26)28-13-18(25)22-14-20(6-2-1-3-7-20)23-8-10-27-11-9-23/h4-5,12,24H,1-3,6-11,13-14H2,(H,22,25) |
| InChIKey | UBSSVOIHNAISNT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |