C19H26F2N2O3 — CID 39430568
2-(2,4-difluorophenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide (PubChem CID 39430568) has the molecular formula C19H26F2N2O3 and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide.
| Compound Name | 2-(2,4-difluorophenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 39430568 |
| Molecular Formula | C19H26F2N2O3 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide |
| SMILES | O=C(COc1ccc(F)cc1F)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C19H26F2N2O3/c20-15-4-5-17(16(21)12-15)26-13-18(24)22-14-19(6-2-1-3-7-19)23-8-10-25-11-9-23/h4-5,12H,1-3,6-11,13-14H2,(H,22,24) |
| InChIKey | UYMBNGKMGLLTMS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |