C12H13F2NO3 — CID 17190869
2-(2,4-difluorophenoxy)-1-morpholin-4-ylethanone (PubChem CID 17190869) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-1-morpholin-4-ylethanone.
| Compound Name | 2-(2,4-difluorophenoxy)-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 17190869 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-1-morpholin-4-ylethanone |
| SMILES | O=C(COc1ccc(F)cc1F)N1CCOCC1 |
| InChI | InChI=1S/C12H13F2NO3/c13-9-1-2-11(10(14)7-9)18-8-12(16)15-3-5-17-6-4-15/h1-2,7H,3-6,8H2 |
| InChIKey | JWZVBRXAVRIMJR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |