C13H16F2N2O2 — CID 124694108
2-(2,4-difluorophenoxy)-1-[(3S)-3-methylpiperazin-1-yl]ethanone (PubChem CID 124694108) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-1-[(3S)-3-methylpiperazin-1-yl]ethanone.
| Compound Name | 2-(2,4-difluorophenoxy)-1-[(3S)-3-methylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 124694108 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-1-[(3S)-3-methylpiperazin-1-yl]ethanone |
| SMILES | C[C@H]1CN(C(=O)COc2ccc(F)cc2F)CCN1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-9-7-17(5-4-16-9)13(18)8-19-12-3-2-10(14)6-11(12)15/h2-3,6,9,16H,4-5,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | BMQHAHXTFLGTCW-VIFPVBQESA-N |
| XLogP | 1.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |