C14H17ClF2N2O2 — CID 120657748
1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2,4-difluorophenoxy)ethanone;hydrochloride (PubChem CID 120657748) has the molecular formula C14H17ClF2N2O2 and a molecular weight of 318.75 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2,4-difluorophenoxy)ethanone;hydrochloride.
| Compound Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2,4-difluorophenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120657748 |
| Molecular Formula | C14H17ClF2N2O2 |
| Molecular Weight | 318.75 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2,4-difluorophenoxy)ethanone;hydrochloride |
| SMILES | Cl.O=C(COc1ccc(F)cc1F)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C14H16F2N2O2.ClH/c15-11-1-2-13(12(16)3-11)20-8-14(19)18-6-9-4-17-5-10(9)7-18;/h1-3,9-10,17H,4-8H2;1H/t9-,10+; |
| InChIKey | CIKZCOWGQROIIX-JMVWIVNTSA-N |
| XLogP | 1.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.75 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |