C17H20F4N2O3 — CID 139450410
1-[(3aR,8aS)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl]-2-[2-fluoro-4-(trifluoromethoxy)phenoxy]ethanone (PubChem CID 139450410) has the molecular formula C17H20F4N2O3 and a molecular weight of 376.35 g/mol. Its IUPAC name is 1-[(3aR,8aS)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl]-2-[2-fluoro-4-(trifluoromethoxy)phenoxy]ethanone.
| Compound Name | 1-[(3aR,8aS)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl]-2-[2-fluoro-4-(trifluoromethoxy)phenoxy]ethanone |
|---|---|
| PubChem CID | 139450410 |
| Molecular Formula | C17H20F4N2O3 |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[(3aR,8aS)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-6-yl]-2-[2-fluoro-4-(trifluoromethoxy)phenoxy]ethanone |
| SMILES | O=C(COc1ccc(OC(F)(F)F)cc1F)N1CC[C@@H]2CNC[C@@H]2CC1 |
| InChI | InChI=1S/C17H20F4N2O3/c18-14-7-13(26-17(19,20)21)1-2-15(14)25-10-16(24)23-5-3-11-8-22-9-12(11)4-6-23/h1-2,7,11-12,22H,3-6,8-10H2/t11-,12+ |
| InChIKey | HXYAVKKICZNNMH-TXEJJXNPSA-N |
| XLogP | 2.56 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |