C14H17FN2O4 — CID 107689861
3-fluoro-4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]benzoic acid (PubChem CID 107689861) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is 3-fluoro-4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]benzoic acid.
| Compound Name | 3-fluoro-4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 107689861 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-fluoro-4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]benzoic acid |
| SMILES | CN1CCN(C(=O)COc2ccc(C(=O)O)cc2F)CC1 |
| InChI | InChI=1S/C14H17FN2O4/c1-16-4-6-17(7-5-16)13(18)9-21-12-3-2-10(14(19)20)8-11(12)15/h2-3,8H,4-7,9H2,1H3,(H,19,20) |
| InChIKey | GGRONKKQVAVPHQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |