About [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate
[2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate (PubChem CID 62681347) has the molecular formula C14H18FN3O3
and a molecular weight of 295.31 g/mol. Its IUPAC name is [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate |
| PubChem CID | 62681347 |
| Molecular Formula | C14H18FN3O3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate |
| SMILES | CN1CCN(C(=O)COC(=O)c2ccc(N)c(F)c2)CC1 |
| InChI | InChI=1S/C14H18FN3O3/c1-17-4-6-18(7-5-17)13(19)9-21-14(20)10-2-3-12(16)11(15)8-10/h2-3,8H,4-7,9,16H2,1H3 |
| InChIKey | HLFYSMXWQJQWEA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate?
The IUPAC name of [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate (CID 62681347) is [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate.
What is the SMILES notation for [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate?
The canonical SMILES for [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate is CN1CCN(C(=O)COC(=O)c2ccc(N)c(F)c2)CC1.
What is the InChIKey of [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate?
The InChIKey is HLFYSMXWQJQWEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FN3O3/c1-17-4-6-18(7-5-17)13(19)9-21-14(20)10-2-3-12(16)11(15)8-10/h2-3,8H,4-7,9,16H2,1H3.
What are the key properties of [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate?
[2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate has a molecular weight of 295.31 g/mol, XLogP of 0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 4-amino-3-fluorobenzoate is sourced from PubChem (CID 62681347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).