C14H20N4O3 — CID 61323119
[2-(4-methylpiperazin-1-yl)-2-oxoethyl] 3,5-diaminobenzoate (PubChem CID 61323119) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 3,5-diaminobenzoate.
| Compound Name | [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 61323119 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | [2-(4-methylpiperazin-1-yl)-2-oxoethyl] 3,5-diaminobenzoate |
| SMILES | CN1CCN(C(=O)COC(=O)c2cc(N)cc(N)c2)CC1 |
| InChI | InChI=1S/C14H20N4O3/c1-17-2-4-18(5-3-17)13(19)9-21-14(20)10-6-11(15)8-12(16)7-10/h6-8H,2-5,9,15-16H2,1H3 |
| InChIKey | XNAZCCKJGBJJJY-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|