C14H16Cl2N2O3 — CID 61322937
(2-oxo-2-piperidin-1-ylethyl) 3-amino-4,5-dichlorobenzoate (PubChem CID 61322937) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 3-amino-4,5-dichlorobenzoate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 3-amino-4,5-dichlorobenzoate |
|---|---|
| PubChem CID | 61322937 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 3-amino-4,5-dichlorobenzoate |
| SMILES | Nc1cc(C(=O)OCC(=O)N2CCCCC2)cc(Cl)c1Cl |
| InChI | InChI=1S/C14H16Cl2N2O3/c15-10-6-9(7-11(17)13(10)16)14(20)21-8-12(19)18-4-2-1-3-5-18/h6-7H,1-5,8,17H2 |
| InChIKey | OUVASDAXCAOPHC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|