C13H17Br2N3O2 — CID 43169638
2-(4-amino-2,6-dibromophenoxy)-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 43169638) has the molecular formula C13H17Br2N3O2 and a molecular weight of 407.11 g/mol. Its IUPAC name is 2-(4-amino-2,6-dibromophenoxy)-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-(4-amino-2,6-dibromophenoxy)-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 43169638 |
| Molecular Formula | C13H17Br2N3O2 |
| Molecular Weight | 407.11 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | 2-(4-amino-2,6-dibromophenoxy)-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)COc2c(Br)cc(N)cc2Br)CC1 |
| InChI | InChI=1S/C13H17Br2N3O2/c1-17-2-4-18(5-3-17)12(19)8-20-13-10(14)6-9(16)7-11(13)15/h6-7H,2-5,8,16H2,1H3 |
| InChIKey | OASKVTRXBDUEMD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.11 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|