C13H18BrN3OS — CID 82841279
2-(4-amino-2-bromophenyl)sulfanyl-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 82841279) has the molecular formula C13H18BrN3OS and a molecular weight of 344.28 g/mol. Its IUPAC name is 2-(4-amino-2-bromophenyl)sulfanyl-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-(4-amino-2-bromophenyl)sulfanyl-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 82841279 |
| Molecular Formula | C13H18BrN3OS |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-(4-amino-2-bromophenyl)sulfanyl-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CSc2ccc(N)cc2Br)CC1 |
| InChI | InChI=1S/C13H18BrN3OS/c1-16-4-6-17(7-5-16)13(18)9-19-12-3-2-10(15)8-11(12)14/h2-3,8H,4-7,9,15H2,1H3 |
| InChIKey | GSDBHFRBYCLZLV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|