C14H19BrN2O2S — CID 82841898
2-(4-amino-2-bromophenyl)sulfanyl-N-(2-methyl-4-oxopentan-3-yl)acetamide (PubChem CID 82841898) has the molecular formula C14H19BrN2O2S and a molecular weight of 359.29 g/mol. Its IUPAC name is 2-(4-amino-2-bromophenyl)sulfanyl-N-(2-methyl-4-oxopentan-3-yl)acetamide.
| Compound Name | 2-(4-amino-2-bromophenyl)sulfanyl-N-(2-methyl-4-oxopentan-3-yl)acetamide |
|---|---|
| PubChem CID | 82841898 |
| Molecular Formula | C14H19BrN2O2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-(4-amino-2-bromophenyl)sulfanyl-N-(2-methyl-4-oxopentan-3-yl)acetamide |
| SMILES | CC(=O)C(NC(=O)CSc1ccc(N)cc1Br)C(C)C |
| InChI | InChI=1S/C14H19BrN2O2S/c1-8(2)14(9(3)18)17-13(19)7-20-12-5-4-10(16)6-11(12)15/h4-6,8,14H,7,16H2,1-3H3,(H,17,19) |
| InChIKey | UZISMYDGMREDOQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|