C13H17BrN2OS — CID 43306100
2-(2-amino-4-bromophenyl)sulfanyl-1-piperidin-1-ylethanone (PubChem CID 43306100) has the molecular formula C13H17BrN2OS and a molecular weight of 329.26 g/mol. Its IUPAC name is 2-(2-amino-4-bromophenyl)sulfanyl-1-piperidin-1-ylethanone.
| Compound Name | 2-(2-amino-4-bromophenyl)sulfanyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 43306100 |
| Molecular Formula | C13H17BrN2OS |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-(2-amino-4-bromophenyl)sulfanyl-1-piperidin-1-ylethanone |
| SMILES | Nc1cc(Br)ccc1SCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C13H17BrN2OS/c14-10-4-5-12(11(15)8-10)18-9-13(17)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7,9,15H2 |
| InChIKey | YOUNLRLFUKEVMU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|