C14H18BrN3O2S — CID 79520324
1-[2-(2-amino-5-bromophenyl)sulfanylacetyl]piperidine-3-carboxamide (PubChem CID 79520324) has the molecular formula C14H18BrN3O2S and a molecular weight of 372.29 g/mol. Its IUPAC name is 1-[2-(2-amino-5-bromophenyl)sulfanylacetyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-(2-amino-5-bromophenyl)sulfanylacetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 79520324 |
| Molecular Formula | C14H18BrN3O2S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 1-[2-(2-amino-5-bromophenyl)sulfanylacetyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(C(=O)CSc2cc(Br)ccc2N)C1 |
| InChI | InChI=1S/C14H18BrN3O2S/c15-10-3-4-11(16)12(6-10)21-8-13(19)18-5-1-2-9(7-18)14(17)20/h3-4,6,9H,1-2,5,7-8,16H2,(H2,17,20) |
| InChIKey | JKEXQDHUFDBDOB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|