C14H18BrNOS — CID 60634872
2-(4-bromo-2-methylphenyl)sulfanyl-1-piperidin-1-ylethanone (PubChem CID 60634872) has the molecular formula C14H18BrNOS and a molecular weight of 328.27 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-1-piperidin-1-ylethanone.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 60634872 |
| Molecular Formula | C14H18BrNOS |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-1-piperidin-1-ylethanone |
| SMILES | Cc1cc(Br)ccc1SCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H18BrNOS/c1-11-9-12(15)5-6-13(11)18-10-14(17)16-7-3-2-4-8-16/h5-6,9H,2-4,7-8,10H2,1H3 |
| InChIKey | UVTCHMKLPMSSIG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |