C16H22BrN3O2S — CID 78803723
2-[4-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]piperazin-1-yl]-N-methylacetamide (PubChem CID 78803723) has the molecular formula C16H22BrN3O2S and a molecular weight of 400.34 g/mol. Its IUPAC name is 2-[4-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]piperazin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]piperazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 78803723 |
| Molecular Formula | C16H22BrN3O2S |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-[4-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]piperazin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCN(C(=O)CSc2ccc(Br)cc2C)CC1 |
| InChI | InChI=1S/C16H22BrN3O2S/c1-12-9-13(17)3-4-14(12)23-11-16(22)20-7-5-19(6-8-20)10-15(21)18-2/h3-4,9H,5-8,10-11H2,1-2H3,(H,18,21) |
| InChIKey | LLJUTTVHULEZNH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |