C17H24BrN3O2S — CID 32522403
2-[4-[[2-(4-bromo-2-methylphenyl)sulfanylacetyl]amino]piperidin-1-yl]-N-methylacetamide (PubChem CID 32522403) has the molecular formula C17H24BrN3O2S and a molecular weight of 414.37 g/mol. Its IUPAC name is 2-[4-[[2-(4-bromo-2-methylphenyl)sulfanylacetyl]amino]piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[[2-(4-bromo-2-methylphenyl)sulfanylacetyl]amino]piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 32522403 |
| Molecular Formula | C17H24BrN3O2S |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-[4-[[2-(4-bromo-2-methylphenyl)sulfanylacetyl]amino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(NC(=O)CSc2ccc(Br)cc2C)CC1 |
| InChI | InChI=1S/C17H24BrN3O2S/c1-12-9-13(18)3-4-15(12)24-11-17(23)20-14-5-7-21(8-6-14)10-16(22)19-2/h3-4,9,14H,5-8,10-11H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | NXWNVVPZUPLNHK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |