C15H21BrN2O3S2 — CID 39999661
2-(4-bromo-2-methylphenyl)sulfanyl-N-(1-methylsulfonylpiperidin-4-yl)acetamide (PubChem CID 39999661) has the molecular formula C15H21BrN2O3S2 and a molecular weight of 421.38 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-N-(1-methylsulfonylpiperidin-4-yl)acetamide.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(1-methylsulfonylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 39999661 |
| Molecular Formula | C15H21BrN2O3S2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(1-methylsulfonylpiperidin-4-yl)acetamide |
| SMILES | Cc1cc(Br)ccc1SCC(=O)NC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H21BrN2O3S2/c1-11-9-12(16)3-4-14(11)22-10-15(19)17-13-5-7-18(8-6-13)23(2,20)21/h3-4,9,13H,5-8,10H2,1-2H3,(H,17,19) |
| InChIKey | ZBLYPJXXHVSLMV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |