C19H27BrN2OS — CID 56568902
2-(4-bromo-2-methylphenyl)sulfanyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide (PubChem CID 56568902) has the molecular formula C19H27BrN2OS and a molecular weight of 411.41 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 56568902 |
| Molecular Formula | C19H27BrN2OS |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)CSc2ccc(Br)cc2C)CC1 |
| InChI | InChI=1S/C19H27BrN2OS/c1-14(2)6-9-22-10-7-17(8-11-22)21-19(23)13-24-18-5-4-16(20)12-15(18)3/h4-6,12,17H,7-11,13H2,1-3H3,(H,21,23) |
| InChIKey | ZXYHNMCIAKHJTD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|