C15H21BrClN3O — CID 103792554
2-[4-[(5-bromo-2-chlorophenyl)methylamino]piperidin-1-yl]-N-methylacetamide (PubChem CID 103792554) has the molecular formula C15H21BrClN3O and a molecular weight of 374.71 g/mol. Its IUPAC name is 2-[4-[(5-bromo-2-chlorophenyl)methylamino]piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[(5-bromo-2-chlorophenyl)methylamino]piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 103792554 |
| Molecular Formula | C15H21BrClN3O |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 2-[4-[(5-bromo-2-chlorophenyl)methylamino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(NCc2cc(Br)ccc2Cl)CC1 |
| InChI | InChI=1S/C15H21BrClN3O/c1-18-15(21)10-20-6-4-13(5-7-20)19-9-11-8-12(16)2-3-14(11)17/h2-3,8,13,19H,4-7,9-10H2,1H3,(H,18,21) |
| InChIKey | VFLYIEXCYXOQIB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |