C12H15BrClNO — CID 115732123
N-[(5-bromo-2-chlorophenyl)methyl]oxan-4-amine (PubChem CID 115732123) has the molecular formula C12H15BrClNO and a molecular weight of 304.62 g/mol. Its IUPAC name is N-[(5-bromo-2-chlorophenyl)methyl]oxan-4-amine.
| Compound Name | N-[(5-bromo-2-chlorophenyl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 115732123 |
| Molecular Formula | C12H15BrClNO |
| Molecular Weight | 304.62 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | N-[(5-bromo-2-chlorophenyl)methyl]oxan-4-amine |
| SMILES | Clc1ccc(Br)cc1CNC1CCOCC1 |
| InChI | InChI=1S/C12H15BrClNO/c13-10-1-2-12(14)9(7-10)8-15-11-3-5-16-6-4-11/h1-2,7,11,15H,3-6,8H2 |
| InChIKey | DHHMEHVJTJUNMI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.62 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |