C11H13Br2N — CID 130682714
N-[(2,5-dibromophenyl)methyl]cyclobutanamine (PubChem CID 130682714) has the molecular formula C11H13Br2N and a molecular weight of 319.04 g/mol. Its IUPAC name is N-[(2,5-dibromophenyl)methyl]cyclobutanamine.
| Compound Name | N-[(2,5-dibromophenyl)methyl]cyclobutanamine |
|---|---|
| PubChem CID | 130682714 |
| Molecular Formula | C11H13Br2N |
| Molecular Weight | 319.04 g/mol |
| Exact Mass | 316.94 |
| IUPAC Name | N-[(2,5-dibromophenyl)methyl]cyclobutanamine |
| SMILES | Brc1ccc(Br)c(CNC2CCC2)c1 |
| InChI | InChI=1S/C11H13Br2N/c12-9-4-5-11(13)8(6-9)7-14-10-2-1-3-10/h4-6,10,14H,1-3,7H2 |
| InChIKey | XUEMFFWJHJFLBF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.04 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |