C15H21BrFN — CID 65079881
N-[(5-bromo-2-fluorophenyl)methyl]-4-methylcycloheptan-1-amine (PubChem CID 65079881) has the molecular formula C15H21BrFN and a molecular weight of 314.24 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-4-methylcycloheptan-1-amine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-4-methylcycloheptan-1-amine |
|---|---|
| PubChem CID | 65079881 |
| Molecular Formula | C15H21BrFN |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-4-methylcycloheptan-1-amine |
| SMILES | CC1CCCC(NCc2cc(Br)ccc2F)CC1 |
| InChI | InChI=1S/C15H21BrFN/c1-11-3-2-4-14(7-5-11)18-10-12-9-13(16)6-8-15(12)17/h6,8-9,11,14,18H,2-5,7,10H2,1H3 |
| InChIKey | ZRGAKJMBFWBPPQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |