C12H15BrFNS — CID 79949958
N-[(5-bromo-2-fluorophenyl)methyl]-5-methylthiolan-3-amine (PubChem CID 79949958) has the molecular formula C12H15BrFNS and a molecular weight of 304.23 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-5-methylthiolan-3-amine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-5-methylthiolan-3-amine |
|---|---|
| PubChem CID | 79949958 |
| Molecular Formula | C12H15BrFNS |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-5-methylthiolan-3-amine |
| SMILES | CC1CC(NCc2cc(Br)ccc2F)CS1 |
| InChI | InChI=1S/C12H15BrFNS/c1-8-4-11(7-16-8)15-6-9-5-10(13)2-3-12(9)14/h2-3,5,8,11,15H,4,6-7H2,1H3 |
| InChIKey | YXABFNKQYVRSQM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |