C13H18BrNO2 — CID 22801896
4-bromo-2-[[[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol (PubChem CID 22801896) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 4-bromo-2-[[[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol.
| Compound Name | 4-bromo-2-[[[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 22801896 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-bromo-2-[[[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol |
| SMILES | Oc1ccc(Br)cc1CN[C@@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C13H18BrNO2/c14-10-4-5-13(17)9(6-10)8-15-11-2-1-3-12(16)7-11/h4-6,11-12,15-17H,1-3,7-8H2/t11-,12+/m1/s1 |
| InChIKey | XAXRZUPFCKWZKL-NEPJUHHUSA-N |
| XLogP | 2.55 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|