C27H30Br3N3O3 — CID 177414869
2-[[[3,5-bis[(5-bromo-2-hydroxyphenyl)methylamino]cyclohexyl]amino]methyl]-4-bromophenol (PubChem CID 177414869) has the molecular formula C27H30Br3N3O3 and a molecular weight of 684.27 g/mol. Its IUPAC name is 2-[[[3,5-bis[(5-bromo-2-hydroxyphenyl)methylamino]cyclohexyl]amino]methyl]-4-bromophenol.
| Compound Name | 2-[[[3,5-bis[(5-bromo-2-hydroxyphenyl)methylamino]cyclohexyl]amino]methyl]-4-bromophenol |
|---|---|
| PubChem CID | 177414869 |
| Molecular Formula | C27H30Br3N3O3 |
| Molecular Weight | 684.27 g/mol |
| Exact Mass | 680.98 |
| IUPAC Name | 2-[[[3,5-bis[(5-bromo-2-hydroxyphenyl)methylamino]cyclohexyl]amino]methyl]-4-bromophenol |
| SMILES | Oc1ccc(Br)cc1CNC1CC(NCc2cc(Br)ccc2O)CC(NCc2cc(Br)ccc2O)C1 |
| InChI | InChI=1S/C27H30Br3N3O3/c28-19-1-4-25(34)16(7-19)13-31-22-10-23(32-14-17-8-20(29)2-5-26(17)35)12-24(11-22)33-15-18-9-21(30)3-6-27(18)36/h1-9,22-24,31-36H,10-15H2 |
| InChIKey | YKSXMEYFFLWXLD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.27 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|