C19H26ClN3O — CID 51079563
N-methyl-2-[4-(naphthalen-1-ylmethylamino)piperidin-1-yl]acetamide;hydrochloride (PubChem CID 51079563) has the molecular formula C19H26ClN3O and a molecular weight of 347.89 g/mol. Its IUPAC name is N-methyl-2-[4-(naphthalen-1-ylmethylamino)piperidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-methyl-2-[4-(naphthalen-1-ylmethylamino)piperidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 51079563 |
| Molecular Formula | C19H26ClN3O |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-methyl-2-[4-(naphthalen-1-ylmethylamino)piperidin-1-yl]acetamide;hydrochloride |
| SMILES | CNC(=O)CN1CCC(NCc2cccc3ccccc23)CC1.Cl |
| InChI | InChI=1S/C19H25N3O.ClH/c1-20-19(23)14-22-11-9-17(10-12-22)21-13-16-7-4-6-15-5-2-3-8-18(15)16;/h2-8,17,21H,9-14H2,1H3,(H,20,23);1H |
| InChIKey | JOFULZVIMAVAFK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |