C14H22BrN3OS — CID 102832453
2-[4-[(4-bromo-5-methylthiophen-2-yl)methylamino]piperidin-1-yl]-N-methylacetamide (PubChem CID 102832453) has the molecular formula C14H22BrN3OS and a molecular weight of 360.32 g/mol. Its IUPAC name is 2-[4-[(4-bromo-5-methylthiophen-2-yl)methylamino]piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[(4-bromo-5-methylthiophen-2-yl)methylamino]piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 102832453 |
| Molecular Formula | C14H22BrN3OS |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-[4-[(4-bromo-5-methylthiophen-2-yl)methylamino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(NCc2cc(Br)c(C)s2)CC1 |
| InChI | InChI=1S/C14H22BrN3OS/c1-10-13(15)7-12(20-10)8-17-11-3-5-18(6-4-11)9-14(19)16-2/h7,11,17H,3-6,8-9H2,1-2H3,(H,16,19) |
| InChIKey | VEVVWEZICJNFNG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |