C12H17BrClN3OS — CID 102833952
2-[4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]piperidin-1-yl]acetamide (PubChem CID 102833952) has the molecular formula C12H17BrClN3OS and a molecular weight of 366.71 g/mol. Its IUPAC name is 2-[4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 102833952 |
| Molecular Formula | C12H17BrClN3OS |
| Molecular Weight | 366.71 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 2-[4-[(4-bromo-5-chlorothiophen-2-yl)methylamino]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(NCc2cc(Br)c(Cl)s2)CC1 |
| InChI | InChI=1S/C12H17BrClN3OS/c13-10-5-9(19-12(10)14)6-16-8-1-3-17(4-2-8)7-11(15)18/h5,8,16H,1-4,6-7H2,(H2,15,18) |
| InChIKey | BHYVCEGVJHCZPD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.71 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |