C11H18N4OS — CID 62759264
2-[4-(1,3-thiazol-5-ylmethylamino)piperidin-1-yl]acetamide (PubChem CID 62759264) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 2-[4-(1,3-thiazol-5-ylmethylamino)piperidin-1-yl]acetamide.
| Compound Name | 2-[4-(1,3-thiazol-5-ylmethylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 62759264 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[4-(1,3-thiazol-5-ylmethylamino)piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(NCc2cncs2)CC1 |
| InChI | InChI=1S/C11H18N4OS/c12-11(16)7-15-3-1-9(2-4-15)14-6-10-5-13-8-17-10/h5,8-9,14H,1-4,6-7H2,(H2,12,16) |
| InChIKey | OFAJDOFNZDGFIB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |