C15H19N3S — CID 103792728
1-phenyl-N-(1,3-thiazol-5-ylmethyl)piperidin-4-amine (PubChem CID 103792728) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-phenyl-N-(1,3-thiazol-5-ylmethyl)piperidin-4-amine.
| Compound Name | 1-phenyl-N-(1,3-thiazol-5-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 103792728 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-phenyl-N-(1,3-thiazol-5-ylmethyl)piperidin-4-amine |
| SMILES | c1ccc(N2CCC(NCc3cncs3)CC2)cc1 |
| InChI | InChI=1S/C15H19N3S/c1-2-4-14(5-3-1)18-8-6-13(7-9-18)17-11-15-10-16-12-19-15/h1-5,10,12-13,17H,6-9,11H2 |
| InChIKey | HMVFWJCSOFOVQY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |