C18H23N3S — CID 99854119
(3aR,4R,6aR)-2-benzyl-N-(1,3-thiazol-5-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 99854119) has the molecular formula C18H23N3S and a molecular weight of 313.47 g/mol. Its IUPAC name is (3aR,4R,6aR)-2-benzyl-N-(1,3-thiazol-5-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4R,6aR)-2-benzyl-N-(1,3-thiazol-5-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 99854119 |
| Molecular Formula | C18H23N3S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (3aR,4R,6aR)-2-benzyl-N-(1,3-thiazol-5-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | c1ccc(CN2C[C@@H]3CC[C@@H](NCc4cncs4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H23N3S/c1-2-4-14(5-3-1)10-21-11-15-6-7-18(17(15)12-21)20-9-16-8-19-13-22-16/h1-5,8,13,15,17-18,20H,6-7,9-12H2/t15-,17-,18+/m0/s1 |
| InChIKey | DBWMNLQTOBNVCP-RYQLBKOJSA-N |
| XLogP | 3.14 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |