C19H25N3S — CID 124734886
(3aR,4S,6aR)-2-benzyl-N-[2-(1,3-thiazol-4-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 124734886) has the molecular formula C19H25N3S and a molecular weight of 327.50 g/mol. Its IUPAC name is (3aR,4S,6aR)-2-benzyl-N-[2-(1,3-thiazol-4-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4S,6aR)-2-benzyl-N-[2-(1,3-thiazol-4-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 124734886 |
| Molecular Formula | C19H25N3S |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (3aR,4S,6aR)-2-benzyl-N-[2-(1,3-thiazol-4-yl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | c1ccc(CN2C[C@@H]3CC[C@H](NCCc4cscn4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C19H25N3S/c1-2-4-15(5-3-1)10-22-11-16-6-7-19(18(16)12-22)20-9-8-17-13-23-14-21-17/h1-5,13-14,16,18-20H,6-12H2/t16-,18-,19-/m0/s1 |
| InChIKey | MUYFVQRVMNTVMC-WDSOQIARSA-N |
| XLogP | 3.19 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |