C18H28N2O — CID 100903162
3-[[(3aS,4R,7aR)-2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]amino]propan-1-ol (PubChem CID 100903162) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 3-[[(3aS,4R,7aR)-2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[(3aS,4R,7aR)-2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 100903162 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 3-[[(3aS,4R,7aR)-2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]amino]propan-1-ol |
| SMILES | OCCCN[C@@H]1CCC[C@H]2CN(Cc3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C18H28N2O/c21-11-5-10-19-18-9-4-8-16-13-20(14-17(16)18)12-15-6-2-1-3-7-15/h1-3,6-7,16-19,21H,4-5,8-14H2/t16-,17+,18+/m0/s1 |
| InChIKey | MMUWRUWNHDGEMC-RCCFBDPRSA-N |
| XLogP | 2.26 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|