C25H33N3O — CID 75452590
3-[(2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)amino]-N-methyl-N-phenylpropanamide (PubChem CID 75452590) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is 3-[(2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)amino]-N-methyl-N-phenylpropanamide.
| Compound Name | 3-[(2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)amino]-N-methyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 75452590 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 3-[(2-benzyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)amino]-N-methyl-N-phenylpropanamide |
| SMILES | CN(C(=O)CCNC1CCCC2CN(Cc3ccccc3)CC21)c1ccccc1 |
| InChI | InChI=1S/C25H33N3O/c1-27(22-12-6-3-7-13-22)25(29)15-16-26-24-14-8-11-21-18-28(19-23(21)24)17-20-9-4-2-5-10-20/h2-7,9-10,12-13,21,23-24,26H,8,11,14-19H2,1H3 |
| InChIKey | XXWRUWGTPKPTDN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |