C20H31N3O — CID 99858578
(3aS,4R,6aS)-2-benzyl-N-(2-morpholin-4-ylethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 99858578) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is (3aS,4R,6aS)-2-benzyl-N-(2-morpholin-4-ylethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aS,4R,6aS)-2-benzyl-N-(2-morpholin-4-ylethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 99858578 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | (3aS,4R,6aS)-2-benzyl-N-(2-morpholin-4-ylethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | c1ccc(CN2C[C@H]3CC[C@@H](NCCN4CCOCC4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C20H31N3O/c1-2-4-17(5-3-1)14-23-15-18-6-7-20(19(18)16-23)21-8-9-22-10-12-24-13-11-22/h1-5,18-21H,6-16H2/t18-,19-,20-/m1/s1 |
| InChIKey | XLPNKMBUYSNUTG-VAMGGRTRSA-N |
| XLogP | 1.82 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |