C24H37N3O — CID 98877631
(3aR,4S,6aR)-2-benzyl-N-[1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 98877631) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is (3aR,4S,6aR)-2-benzyl-N-[1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4S,6aR)-2-benzyl-N-[1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 98877631 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | (3aR,4S,6aR)-2-benzyl-N-[1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | c1ccc(CN2C[C@@H]3CC[C@H](NC4CCN(C[C@@H]5CCOC5)CC4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C24H37N3O/c1-2-4-19(5-3-1)14-27-16-21-6-7-24(23(21)17-27)25-22-8-11-26(12-9-22)15-20-10-13-28-18-20/h1-5,20-25H,6-18H2/t20-,21-,23-,24-/m0/s1 |
| InChIKey | QDUABLWEOHMWCC-WMIMKTLMSA-N |
| XLogP | 2.99 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |