C23H36N2O — CID 100909093
(3aS,4R,6aS)-2-benzyl-N-(4-propan-2-yloxycyclohexyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 100909093) has the molecular formula C23H36N2O and a molecular weight of 356.55 g/mol. Its IUPAC name is (3aS,4R,6aS)-2-benzyl-N-(4-propan-2-yloxycyclohexyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aS,4R,6aS)-2-benzyl-N-(4-propan-2-yloxycyclohexyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 100909093 |
| Molecular Formula | C23H36N2O |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | (3aS,4R,6aS)-2-benzyl-N-(4-propan-2-yloxycyclohexyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | CC(C)OC1CCC(N[C@@H]2CC[C@@H]3CN(Cc4ccccc4)C[C@H]32)CC1 |
| InChI | InChI=1S/C23H36N2O/c1-17(2)26-21-11-9-20(10-12-21)24-23-13-8-19-15-25(16-22(19)23)14-18-6-4-3-5-7-18/h3-7,17,19-24H,8-16H2,1-2H3/t19-,20?,21?,22-,23-/m1/s1 |
| InChIKey | SKPYXSFULBZORD-FQUXPLTJSA-N |
| XLogP | 4.22 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |