C21H33N3O — CID 46213873
(2S,3S)-N-[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-(methylamino)pentanamide (PubChem CID 46213873) has the molecular formula C21H33N3O and a molecular weight of 343.52 g/mol. Its IUPAC name is (2S,3S)-N-[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-(methylamino)pentanamide.
| Compound Name | (2S,3S)-N-[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 46213873 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | (2S,3S)-N-[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-(methylamino)pentanamide |
| SMILES | CC[C@H](C)[C@H](NC)C(=O)N[C@@H]1CC[C@H]2CN(Cc3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C21H33N3O/c1-4-15(2)20(22-3)21(25)23-19-11-10-17-13-24(14-18(17)19)12-16-8-6-5-7-9-16/h5-9,15,17-20,22H,4,10-14H2,1-3H3,(H,23,25)/t15-,17-,18+,19+,20-/m0/s1 |
| InChIKey | GFHLHVMTOHMCFF-FLNBYBTLSA-N |
| XLogP | 2.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |