C20H31N3O — CID 66590025
(2S)-N-[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-3,3-dimethylbutanamide (PubChem CID 66590025) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-3,3-dimethylbutanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 66590025 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-amino-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)N[C@H]1CC[C@@H]2CN(Cc3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C20H31N3O/c1-20(2,3)18(21)19(24)22-17-10-9-15-12-23(13-16(15)17)11-14-7-5-4-6-8-14/h4-8,15-18H,9-13,21H2,1-3H3,(H,22,24)/t15-,16+,17+,18-/m1/s1 |
| InChIKey | LIFHZRITXXQUCM-VSZNYVQBSA-N |
| XLogP | 2.39 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |