C24H37N3O3 — CID 66590966
[(3S)-3-[[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]-2,2-dimethylhexan-3-yl] carbamate (PubChem CID 66590966) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is [(3S)-3-[[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]-2,2-dimethylhexan-3-yl] carbamate.
| Compound Name | [(3S)-3-[[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]-2,2-dimethylhexan-3-yl] carbamate |
|---|---|
| PubChem CID | 66590966 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | [(3S)-3-[[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]-2,2-dimethylhexan-3-yl] carbamate |
| SMILES | CCC[C@@](OC(N)=O)(C(=O)N[C@@H]1CC[C@H]2CN(Cc3ccccc3)C[C@H]21)C(C)(C)C |
| InChI | InChI=1S/C24H37N3O3/c1-5-13-24(23(2,3)4,30-22(25)29)21(28)26-20-12-11-18-15-27(16-19(18)20)14-17-9-7-6-8-10-17/h6-10,18-20H,5,11-16H2,1-4H3,(H2,25,29)(H,26,28)/t18-,19+,20+,24+/m0/s1 |
| InChIKey | NRHXNDXSPQTUKN-UECWXEIQSA-N |
| XLogP | 3.69 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |