C15H20N2O2 — CID 90406485
(1-benzyl-4-cyclopropylpyrrolidin-3-yl)carbamic acid (PubChem CID 90406485) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (1-benzyl-4-cyclopropylpyrrolidin-3-yl)carbamic acid.
| Compound Name | (1-benzyl-4-cyclopropylpyrrolidin-3-yl)carbamic acid |
|---|---|
| PubChem CID | 90406485 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (1-benzyl-4-cyclopropylpyrrolidin-3-yl)carbamic acid |
| SMILES | O=C(O)NC1CN(Cc2ccccc2)CC1C1CC1 |
| InChI | InChI=1S/C15H20N2O2/c18-15(19)16-14-10-17(9-13(14)12-6-7-12)8-11-4-2-1-3-5-11/h1-5,12-14,16H,6-10H2,(H,18,19) |
| InChIKey | CBOPZPIOIFZWNO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |