C15H21N3S — CID 130624142
(2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)thiourea (PubChem CID 130624142) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is (2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)thiourea.
| Compound Name | (2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)thiourea |
|---|---|
| PubChem CID | 130624142 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)thiourea |
| SMILES | NC(=S)NC1CCC2CN(Cc3ccccc3)CC21 |
| InChI | InChI=1S/C15H21N3S/c16-15(19)17-14-7-6-12-9-18(10-13(12)14)8-11-4-2-1-3-5-11/h1-5,12-14H,6-10H2,(H3,16,17,19) |
| InChIKey | ZVPYIEIMVGITGZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|