[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid

C14H20N2O2 — CID 137369868

IUPAC[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid
SMILESC[C@H]1CCN(Cc2ccccc2)C[C@H]1NC(=O)O
InChIInChI=1S/C14H20N2O2/c1-11-7-8-16(10-13(11)15-14(17)18)9-12-5-3-2-4-6-12/h2-6,11,13,15H,7-10H2,1H3,(H,17,18)/t11-,13+/m0/s1
InChIKeyUMEPCDHPTVWXMU-WCQYABFASA-N
MW248.33 g/mol
LogP2.16
Rot. Bonds3

About [(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid

[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid (PubChem CID 137369868) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is [(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid.

Molecular Properties

Compound Name[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid
PubChem CID137369868
Molecular FormulaC14H20N2O2
Molecular Weight248.33 g/mol
Exact Mass248.15
IUPAC Name[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid
SMILESC[C@H]1CCN(Cc2ccccc2)C[C@H]1NC(=O)O
InChIInChI=1S/C14H20N2O2/c1-11-7-8-16(10-13(11)15-14(17)18)9-12-5-3-2-4-6-12/h2-6,11,13,15H,7-10H2,1H3,(H,17,18)/t11-,13+/m0/s1
InChIKeyUMEPCDHPTVWXMU-WCQYABFASA-N
XLogP2.16
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.33
LogP ≤ 52.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze [(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid?
The IUPAC name of [(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid (CID 137369868) is [(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid.
What is the SMILES notation for [(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid?
The canonical SMILES for [(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid is C[C@H]1CCN(Cc2ccccc2)C[C@H]1NC(=O)O.
What is the InChIKey of [(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid?
The InChIKey is UMEPCDHPTVWXMU-WCQYABFASA-N. The full InChI is InChI=1S/C14H20N2O2/c1-11-7-8-16(10-13(11)15-14(17)18)9-12-5-3-2-4-6-12/h2-6,11,13,15H,7-10H2,1H3,(H,17,18)/t11-,13+/m0/s1.
What are the key properties of [(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid?
[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid has a molecular weight of 248.33 g/mol, XLogP of 2.16, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]carbamic acid is sourced from PubChem (CID 137369868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).