C16H22N2O2 — CID 20792051
[(8R)-5-benzyl-8-methyl-5-azaspiro[2.5]octan-7-yl]carbamic acid (PubChem CID 20792051) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is [(8R)-5-benzyl-8-methyl-5-azaspiro[2.5]octan-7-yl]carbamic acid.
| Compound Name | [(8R)-5-benzyl-8-methyl-5-azaspiro[2.5]octan-7-yl]carbamic acid |
|---|---|
| PubChem CID | 20792051 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | [(8R)-5-benzyl-8-methyl-5-azaspiro[2.5]octan-7-yl]carbamic acid |
| SMILES | C[C@H]1C(NC(=O)O)CN(Cc2ccccc2)CC12CC2 |
| InChI | InChI=1S/C16H22N2O2/c1-12-14(17-15(19)20)10-18(11-16(12)7-8-16)9-13-5-3-2-4-6-13/h2-6,12,14,17H,7-11H2,1H3,(H,19,20)/t12-,14?/m0/s1 |
| InChIKey | YNWCFAFLHSUZEE-NBFOIZRFSA-N |
| XLogP | 2.55 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |